C22H17N3O4 — CID 45212245
(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)-(2-phenyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methanone (PubChem CID 45212245) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is (1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)-(2-phenyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methanone.
| Compound Name | (1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)-(2-phenyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methanone |
|---|---|
| PubChem CID | 45212245 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)-(2-phenyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)no[n+]2[O-])N1Cc2ccccc2OC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H17N3O4/c26-22(16-10-11-19-18(12-16)23-29-25(19)27)24-13-17-8-4-5-9-20(17)28-21(14-24)15-6-2-1-3-7-15/h1-12,21H,13-14H2 |
| InChIKey | KCFWJEHMEUFNRX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|