C17H15BrCl2N2O4 — CID 4521282
N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 4521282) has the molecular formula C17H15BrCl2N2O4 and a molecular weight of 462.13 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4521282 |
| Molecular Formula | C17H15BrCl2N2O4 |
| Molecular Weight | 462.13 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | CCOc1cc(C=NNC(=O)COc2ccc(Cl)cc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C17H15BrCl2N2O4/c1-2-25-15-6-10(5-12(18)17(15)24)8-21-22-16(23)9-26-14-4-3-11(19)7-13(14)20/h3-8,24H,2,9H2,1H3,(H,22,23) |
| InChIKey | HWJCVCHYDHTQMV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|