C29H35N3O4 — CID 45213207
methyl 9-[(1-methylpiperidin-3-yl)methoxy]-3-(naphthalen-1-ylmethyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 45213207) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is methyl 9-[(1-methylpiperidin-3-yl)methoxy]-3-(naphthalen-1-ylmethyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 9-[(1-methylpiperidin-3-yl)methoxy]-3-(naphthalen-1-ylmethyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 45213207 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | methyl 9-[(1-methylpiperidin-3-yl)methoxy]-3-(naphthalen-1-ylmethyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCC2CCCN(C)C2)cc(=O)n2c1CCN(Cc1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C29H35N3O4/c1-30-13-6-7-21(18-30)20-36-26-17-27(33)32-16-15-31(14-12-25(32)28(26)29(34)35-2)19-23-10-5-9-22-8-3-4-11-24(22)23/h3-5,8-11,17,21H,6-7,12-16,18-20H2,1-2H3 |
| InChIKey | QKXNFPBLJMKONS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |