About 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one
5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one (PubChem CID 45214344) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one |
| PubChem CID | 45214344 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one |
| SMILES | CC1(CCC(=O)N2CCC3(C=Cc4ccccc43)CC2)CCC(=O)N1 |
| InChI | InChI=1S/C21H26N2O2/c1-20(9-7-18(24)22-20)10-8-19(25)23-14-12-21(13-15-23)11-6-16-4-2-3-5-17(16)21/h2-6,11H,7-10,12-15H2,1H3,(H,22,24) |
| InChIKey | NIGBAGTWDIYXTE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one?
The IUPAC name of 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one (CID 45214344) is 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one.
What is the SMILES notation for 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one?
The canonical SMILES for 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one is CC1(CCC(=O)N2CCC3(C=Cc4ccccc43)CC2)CCC(=O)N1.
What is the InChIKey of 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one?
The InChIKey is NIGBAGTWDIYXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2/c1-20(9-7-18(24)22-20)10-8-19(25)23-14-12-21(13-15-23)11-6-16-4-2-3-5-17(16)21/h2-6,11H,7-10,12-15H2,1H3,(H,22,24).
What are the key properties of 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one?
5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one has a molecular weight of 338.45 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-(3-oxo-3-spiro[indene-1,4'-piperidine]-1'-ylpropyl)pyrrolidin-2-one is sourced from PubChem (CID 45214344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).