C17H29N3O2 — CID 45214691
2-[1-(2,2-dimethylpropyl)-3-oxopiperazin-2-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 45214691) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-3-oxopiperazin-2-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[1-(2,2-dimethylpropyl)-3-oxopiperazin-2-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 45214691 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-3-oxopiperazin-2-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CC1C(=O)NCCN1CC(C)(C)C |
| InChI | InChI=1S/C17H29N3O2/c1-6-9-19(10-7-2)15(21)12-14-16(22)18-8-11-20(14)13-17(3,4)5/h6-7,14H,1-2,8-13H2,3-5H3,(H,18,22) |
| InChIKey | XQXRJDBSCORQKP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|