C25H19F4NO3 — CID 45214747
N-[[7-(5-acetyl-2-fluorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl]-2,3,6-trifluorobenzamide (PubChem CID 45214747) has the molecular formula C25H19F4NO3 and a molecular weight of 457.42 g/mol. Its IUPAC name is N-[[7-(5-acetyl-2-fluorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl]-2,3,6-trifluorobenzamide.
| Compound Name | N-[[7-(5-acetyl-2-fluorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl]-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 45214747 |
| Molecular Formula | C25H19F4NO3 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-[[7-(5-acetyl-2-fluorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl]-2,3,6-trifluorobenzamide |
| SMILES | CC(=O)c1ccc(F)c(-c2cc(C)cc3c2OC(CNC(=O)c2c(F)ccc(F)c2F)C3)c1 |
| InChI | InChI=1S/C25H19F4NO3/c1-12-7-15-9-16(11-30-25(32)22-20(27)5-6-21(28)23(22)29)33-24(15)18(8-12)17-10-14(13(2)31)3-4-19(17)26/h3-8,10,16H,9,11H2,1-2H3,(H,30,32) |
| InChIKey | RORFIRCNPITETI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|