C23H27N3O4 — CID 45214832
3-[1-(oxolane-3-carbonyl)piperidin-4-yl]oxy-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 45214832) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[1-(oxolane-3-carbonyl)piperidin-4-yl]oxy-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-[1-(oxolane-3-carbonyl)piperidin-4-yl]oxy-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 45214832 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-[1-(oxolane-3-carbonyl)piperidin-4-yl]oxy-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1cccc(OC2CCN(C(=O)C3CCOC3)CC2)c1 |
| InChI | InChI=1S/C23H27N3O4/c27-22(25-15-17-3-2-9-24-14-17)18-4-1-5-21(13-18)30-20-6-10-26(11-7-20)23(28)19-8-12-29-16-19/h1-5,9,13-14,19-20H,6-8,10-12,15-16H2,(H,25,27) |
| InChIKey | LJFFMVLXBWQEQO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |