About 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine
4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine (PubChem CID 45215473) has the molecular formula C15H25ClN4O
and a molecular weight of 312.85 g/mol. Its IUPAC name is 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine |
| PubChem CID | 45215473 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C15H25ClN4O/c1-12-14(15(16)18(2)17-12)11-19-5-3-4-13(10-19)20-6-8-21-9-7-20/h13H,3-11H2,1-2H3 |
| InChIKey | ACCCPSGXXYRGAU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine?
The IUPAC name of 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine (CID 45215473) is 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine.
What is the SMILES notation for 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine?
The canonical SMILES for 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine is Cc1nn(C)c(Cl)c1CN1CCCC(N2CCOCC2)C1.
What is the InChIKey of 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine?
The InChIKey is ACCCPSGXXYRGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25ClN4O/c1-12-14(15(16)18(2)17-12)11-19-5-3-4-13(10-19)20-6-8-21-9-7-20/h13H,3-11H2,1-2H3.
What are the key properties of 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine?
4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine has a molecular weight of 312.85 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]morpholine is sourced from PubChem (CID 45215473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).