C24H29N3O — CID 45215958
N-[(3-cyclopentyloxyphenyl)methyl]-1-(5-methyl-1-phenylpyrazol-4-yl)ethanamine (PubChem CID 45215958) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[(3-cyclopentyloxyphenyl)methyl]-1-(5-methyl-1-phenylpyrazol-4-yl)ethanamine.
| Compound Name | N-[(3-cyclopentyloxyphenyl)methyl]-1-(5-methyl-1-phenylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 45215958 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[(3-cyclopentyloxyphenyl)methyl]-1-(5-methyl-1-phenylpyrazol-4-yl)ethanamine |
| SMILES | Cc1c(C(C)NCc2cccc(OC3CCCC3)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C24H29N3O/c1-18(24-17-26-27(19(24)2)21-10-4-3-5-11-21)25-16-20-9-8-14-23(15-20)28-22-12-6-7-13-22/h3-5,8-11,14-15,17-18,22,25H,6-7,12-13,16H2,1-2H3 |
| InChIKey | JUSARYURLVCYEY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |