About 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine
5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine (PubChem CID 45216000) has the molecular formula C19H17FN6O
and a molecular weight of 364.38 g/mol. Its IUPAC name is 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine |
| PubChem CID | 45216000 |
| Molecular Formula | C19H17FN6O |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(Cn1cccn1)Nc1ccc(-c2nc(-c3ccccc3F)no2)cn1 |
| InChI | InChI=1S/C19H17FN6O/c1-13(12-26-10-4-9-22-26)23-17-8-7-14(11-21-17)19-24-18(25-27-19)15-5-2-3-6-16(15)20/h2-11,13H,12H2,1H3,(H,21,23) |
| InChIKey | TVJSFPWFSQBTDS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine?
The IUPAC name of 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine (CID 45216000) is 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine.
What is the SMILES notation for 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine?
The canonical SMILES for 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine is CC(Cn1cccn1)Nc1ccc(-c2nc(-c3ccccc3F)no2)cn1.
What is the InChIKey of 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine?
The InChIKey is TVJSFPWFSQBTDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN6O/c1-13(12-26-10-4-9-22-26)23-17-8-7-14(11-21-17)19-24-18(25-27-19)15-5-2-3-6-16(15)20/h2-11,13H,12H2,1H3,(H,21,23).
What are the key properties of 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine?
5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine has a molecular weight of 364.38 g/mol, XLogP of 3.63, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(1-pyrazol-1-ylpropan-2-yl)pyridin-2-amine is sourced from PubChem (CID 45216000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).