C17H14N4O2S — CID 4521632
5-[[4-(dimethylamino)phenyl]methylidene]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 4521632) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylidene]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 4521632 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CN(C)c1ccc(C=c2sc3nc(-c4ccco4)nn3c2=O)cc1 |
| InChI | InChI=1S/C17H14N4O2S/c1-20(2)12-7-5-11(6-8-12)10-14-16(22)21-17(24-14)18-15(19-21)13-4-3-9-23-13/h3-10H,1-2H3 |
| InChIKey | PRTMZXIHNHIJOX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|