C18H31N3O4S — CID 45216916
1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-ol (PubChem CID 45216916) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-ol.
| Compound Name | 1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 45216916 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-ol |
| SMILES | COCCCn1c(CN2CCCC(O)C2)cnc1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C18H31N3O4S/c1-25-11-5-10-21-15(13-20-9-4-6-16(22)14-20)12-19-18(21)26(23,24)17-7-2-3-8-17/h12,16-17,22H,2-11,13-14H2,1H3 |
| InChIKey | DTCRWCHIVZVEGP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|