C27H36N2O2 — CID 45217634
N-[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-phenylethyl]-N,2-dimethylfuran-3-carboxamide (PubChem CID 45217634) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-phenylethyl]-N,2-dimethylfuran-3-carboxamide.
| Compound Name | N-[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-phenylethyl]-N,2-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 45217634 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[1-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-phenylethyl]-N,2-dimethylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(C)C(Cc1ccccc1)C1CCN(CC2CC=CCC2)CC1 |
| InChI | InChI=1S/C27H36N2O2/c1-21-25(15-18-31-21)27(30)28(2)26(19-22-9-5-3-6-10-22)24-13-16-29(17-14-24)20-23-11-7-4-8-12-23/h3-7,9-10,15,18,23-24,26H,8,11-14,16-17,19-20H2,1-2H3 |
| InChIKey | MCKYFIBRYHNAPJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|