About methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate
methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate (PubChem CID 45218000) has the molecular formula C21H23N3O3S
and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate |
| PubChem CID | 45218000 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(CN3CCCCC3c3nccs3)c(C)o2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-17(13-24-11-4-3-5-18(24)20-22-10-12-28-20)23-19(27-14)15-6-8-16(9-7-15)21(25)26-2/h6-10,12,18H,3-5,11,13H2,1-2H3 |
| InChIKey | CBMJKAJTBFEQHO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate?
The IUPAC name of methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate (CID 45218000) is methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate.
What is the SMILES notation for methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate?
The canonical SMILES for methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate is COC(=O)c1ccc(-c2nc(CN3CCCCC3c3nccs3)c(C)o2)cc1.
What is the InChIKey of methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate?
The InChIKey is CBMJKAJTBFEQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3S/c1-14-17(13-24-11-4-3-5-18(24)20-22-10-12-28-20)23-19(27-14)15-6-8-16(9-7-15)21(25)26-2/h6-10,12,18H,3-5,11,13H2,1-2H3.
What are the key properties of methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate?
methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate has a molecular weight of 397.50 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-methyl-4-[[2-(1,3-thiazol-2-yl)piperidin-1-yl]methyl]-1,3-oxazol-2-yl]benzoate is sourced from PubChem (CID 45218000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).