C21H20ClN3O3S — CID 45218209
2-(6-chloro-1,3-benzodioxol-5-yl)-8-methoxy-5-(1H-pyrazol-5-ylmethyl)-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 45218209) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-5-yl)-8-methoxy-5-(1H-pyrazol-5-ylmethyl)-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-8-methoxy-5-(1H-pyrazol-5-ylmethyl)-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 45218209 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-8-methoxy-5-(1H-pyrazol-5-ylmethyl)-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | COc1ccc2c(c1)SC(c1cc3c(cc1Cl)OCO3)CCN2Cc1ccn[nH]1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-26-14-2-3-17-21(8-14)29-20(5-7-25(17)11-13-4-6-23-24-13)15-9-18-19(10-16(15)22)28-12-27-18/h2-4,6,8-10,20H,5,7,11-12H2,1H3,(H,23,24) |
| InChIKey | WROMWSCALBXHKE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|