C21H34N2O2 — CID 45219091
1-(1-cyclopentylpiperidin-4-yl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)methanamine (PubChem CID 45219091) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(1-cyclopentylpiperidin-4-yl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)methanamine.
| Compound Name | 1-(1-cyclopentylpiperidin-4-yl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 45219091 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-(1-cyclopentylpiperidin-4-yl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)methanamine |
| SMILES | c1coc(CN(CC2CCN(C3CCCC3)CC2)CC2CCCO2)c1 |
| InChI | InChI=1S/C21H34N2O2/c1-2-6-19(5-1)23-11-9-18(10-12-23)15-22(16-20-7-3-13-24-20)17-21-8-4-14-25-21/h3,7,13,18-19,21H,1-2,4-6,8-12,14-17H2 |
| InChIKey | BTXGYOZPEIYODY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |