C21H17F2N3O2 — CID 45219196
[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone (PubChem CID 45219196) has the molecular formula C21H17F2N3O2 and a molecular weight of 381.38 g/mol. Its IUPAC name is [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone.
| Compound Name | [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 45219196 |
| Molecular Formula | C21H17F2N3O2 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,3-dihydro-1-benzofuran-2-yl)methanone |
| SMILES | O=C(C1Cc2ccccc2O1)N1CCc2[nH]nc(-c3ccc(F)c(F)c3)c2C1 |
| InChI | InChI=1S/C21H17F2N3O2/c22-15-6-5-13(9-16(15)23)20-14-11-26(8-7-17(14)24-25-20)21(27)19-10-12-3-1-2-4-18(12)28-19/h1-6,9,19H,7-8,10-11H2,(H,24,25) |
| InChIKey | DHCORLXHWXXPSZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |