C24H29N5O2 — CID 45219847
4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione (PubChem CID 45219847) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45219847 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(CC4CC=CCC4)CC3)c2C(=O)N1CCn1cccn1 |
| InChI | InChI=1S/C24H29N5O2/c30-23-20-8-4-9-21(22(20)24(31)29(23)17-16-28-11-5-10-25-28)27-14-12-26(13-15-27)18-19-6-2-1-3-7-19/h1-2,4-5,8-11,19H,3,6-7,12-18H2 |
| InChIKey | KIIGJUWADWUONC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|