C32H40N4O3 — CID 45220126
[(2S,4S)-1-benzyl-4-[[4-(dimethylamino)phenyl]methylamino]pyrrolidin-2-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 45220126) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is [(2S,4S)-1-benzyl-4-[[4-(dimethylamino)phenyl]methylamino]pyrrolidin-2-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [(2S,4S)-1-benzyl-4-[[4-(dimethylamino)phenyl]methylamino]pyrrolidin-2-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 45220126 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(2S,4S)-1-benzyl-4-[[4-(dimethylamino)phenyl]methylamino]pyrrolidin-2-yl]-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)[C@@H]1C[C@H](NCc3ccc(N(C)C)cc3)CN1Cc1ccccc1)CC2 |
| InChI | InChI=1S/C32H40N4O3/c1-34(2)28-12-10-23(11-13-28)19-33-27-18-29(36(22-27)20-24-8-6-5-7-9-24)32(37)35-15-14-25-16-30(38-3)31(39-4)17-26(25)21-35/h5-13,16-17,27,29,33H,14-15,18-22H2,1-4H3/t27-,29-/m0/s1 |
| InChIKey | YBEBVLVMRYJFCK-YTMVLYRLSA-N |
| XLogP | 4.09 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|