C19H24FN3O — CID 45220816
(1-ethylpyrazol-4-yl)-[3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 45220816) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-[3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (1-ethylpyrazol-4-yl)-[3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45220816 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-[3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | CCn1cc(C(=O)N2CCCC(CCc3ccccc3F)C2)cn1 |
| InChI | InChI=1S/C19H24FN3O/c1-2-23-14-17(12-21-23)19(24)22-11-5-6-15(13-22)9-10-16-7-3-4-8-18(16)20/h3-4,7-8,12,14-15H,2,5-6,9-11,13H2,1H3 |
| InChIKey | HKSKHMIDHNEOPE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |