C33H42N6O3 — CID 45220969
methyl 1-[(3S,5S)-5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]-1-[[3-(2-methylphenyl)phenyl]methyl]pyrrolidin-3-yl]triazole-4-carboxylate (PubChem CID 45220969) has the molecular formula C33H42N6O3 and a molecular weight of 570.74 g/mol. Its IUPAC name is methyl 1-[(3S,5S)-5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]-1-[[3-(2-methylphenyl)phenyl]methyl]pyrrolidin-3-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3S,5S)-5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]-1-[[3-(2-methylphenyl)phenyl]methyl]pyrrolidin-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 45220969 |
| Molecular Formula | C33H42N6O3 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | methyl 1-[(3S,5S)-5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]-1-[[3-(2-methylphenyl)phenyl]methyl]pyrrolidin-3-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@H]2C[C@@H](C(=O)NC[C@@H]3CCCN4CCCC[C@H]34)N(Cc3cccc(-c4ccccc4C)c3)C2)nn1 |
| InChI | InChI=1S/C33H42N6O3/c1-23-9-3-4-13-28(23)25-11-7-10-24(17-25)20-38-21-27(39-22-29(35-36-39)33(41)42-2)18-31(38)32(40)34-19-26-12-8-16-37-15-6-5-14-30(26)37/h3-4,7,9-11,13,17,22,26-27,30-31H,5-6,8,12,14-16,18-21H2,1-2H3,(H,34,40)/t26-,27-,30+,31-/m0/s1 |
| InChIKey | GAXSRYPKXJSOJM-FOHQDORMSA-N |
| XLogP | 4.24 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |