C22H23N3O3 — CID 45222272
methyl 3-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethylcarbamoyl]benzoate (PubChem CID 45222272) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 3-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethylcarbamoyl]benzoate.
| Compound Name | methyl 3-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 45222272 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl 3-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(C)c2cnn(-c3ccccc3C)c2C)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-8-5-6-11-20(14)25-16(3)19(13-23-25)15(2)24-21(26)17-9-7-10-18(12-17)22(27)28-4/h5-13,15H,1-4H3,(H,24,26) |
| InChIKey | FPQCLJFNCRTCEX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |