C27H19Cl2NO3 — CID 4522231
5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one (PubChem CID 4522231) has the molecular formula C27H19Cl2NO3 and a molecular weight of 476.36 g/mol. Its IUPAC name is 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one.
| Compound Name | 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one |
|---|---|
| PubChem CID | 4522231 |
| Molecular Formula | C27H19Cl2NO3 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2ccccc2Cl)c2ccc(Cl)cc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H19Cl2NO3/c28-19-12-13-24-22(14-19)27(33,26(32)30(24)16-18-7-2-4-11-23(18)29)15-25(31)21-10-5-8-17-6-1-3-9-20(17)21/h1-14,33H,15-16H2 |
| InChIKey | WLPQHPRKWCFHRD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |