C20H33N3O2 — CID 45224052
1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 45224052) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45224052 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN(C2CCN(C(=O)C3CCCC3)CC2)C1 |
| InChI | InChI=1S/C20H33N3O2/c24-19(21-17-7-8-17)16-6-3-11-23(14-16)18-9-12-22(13-10-18)20(25)15-4-1-2-5-15/h15-18H,1-14H2,(H,21,24) |
| InChIKey | HHCAYJNLXZXMDI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |