C24H36N6O — CID 45224450
N-[2-[7-[(2,5-dimethylphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]-1-methylpiperidine-3-carboxamide (PubChem CID 45224450) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[2-[7-[(2,5-dimethylphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]-1-methylpiperidine-3-carboxamide.
| Compound Name | N-[2-[7-[(2,5-dimethylphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]-1-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45224450 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | N-[2-[7-[(2,5-dimethylphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]-1-methylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(CN2CCc3nnc(CCNC(=O)C4CCCN(C)C4)n3CC2)c1 |
| InChI | InChI=1S/C24H36N6O/c1-18-6-7-19(2)21(15-18)17-29-12-9-23-27-26-22(30(23)14-13-29)8-10-25-24(31)20-5-4-11-28(3)16-20/h6-7,15,20H,4-5,8-14,16-17H2,1-3H3,(H,25,31) |
| InChIKey | CJYZVHICUZNKIG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |