C22H34FN3O — CID 45225577
N-[2-(dimethylamino)ethyl]-N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]methyl]pent-4-enamide (PubChem CID 45225577) has the molecular formula C22H34FN3O and a molecular weight of 375.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]methyl]pent-4-enamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 45225577 |
| Molecular Formula | C22H34FN3O |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)N(CCN(C)C)CC1CCCN(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C22H34FN3O/c1-4-5-12-22(27)26(15-14-24(2)3)17-19-9-8-13-25(16-19)18-20-10-6-7-11-21(20)23/h4,6-7,10-11,19H,1,5,8-9,12-18H2,2-3H3 |
| InChIKey | DXQIYTNAPIDGBW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|