C29H29ClN2O4 — CID 45227672
(E)-3-(2-chlorophenyl)-1-[9-(oxan-2-ylmethoxy)-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]prop-2-en-1-one (PubChem CID 45227672) has the molecular formula C29H29ClN2O4 and a molecular weight of 505.01 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[9-(oxan-2-ylmethoxy)-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[9-(oxan-2-ylmethoxy)-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45227672 |
| Molecular Formula | C29H29ClN2O4 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[9-(oxan-2-ylmethoxy)-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCOc2c(cc(-c3cccnc3)cc2OCC2CCCCO2)C1 |
| InChI | InChI=1S/C29H29ClN2O4/c30-26-9-2-1-6-21(26)10-11-28(33)32-13-15-35-29-24(19-32)16-23(22-7-5-12-31-18-22)17-27(29)36-20-25-8-3-4-14-34-25/h1-2,5-7,9-12,16-18,25H,3-4,8,13-15,19-20H2/b11-10+ |
| InChIKey | JZXWTDBNDZPUPG-ZHACJKMWSA-N |
| XLogP | 5.78 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|