C22H34N2O3 — CID 45227699
2-(cyclohexen-1-yl)-1-[2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethanone (PubChem CID 45227699) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 45227699 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)C2CC23CCN(C(=O)CC2=CCCCC2)CC3)C[C@H](C)O1 |
| InChI | InChI=1S/C22H34N2O3/c1-16-14-24(15-17(2)27-16)21(26)19-13-22(19)8-10-23(11-9-22)20(25)12-18-6-4-3-5-7-18/h6,16-17,19H,3-5,7-15H2,1-2H3/t16-,17+,19? |
| InChIKey | WJNPVVSRLCFGDF-JJTKIYQPSA-N |
| XLogP | 3.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|