C19H29N5OS — CID 45227943
[1-[[1-[[5-(oxan-2-yl)thiophen-2-yl]methyl]piperidin-4-yl]methyl]triazol-4-yl]methanamine (PubChem CID 45227943) has the molecular formula C19H29N5OS and a molecular weight of 375.54 g/mol. Its IUPAC name is [1-[[1-[[5-(oxan-2-yl)thiophen-2-yl]methyl]piperidin-4-yl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[1-[[5-(oxan-2-yl)thiophen-2-yl]methyl]piperidin-4-yl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 45227943 |
| Molecular Formula | C19H29N5OS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | [1-[[1-[[5-(oxan-2-yl)thiophen-2-yl]methyl]piperidin-4-yl]methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(CC2CCN(Cc3ccc(C4CCCCO4)s3)CC2)nn1 |
| InChI | InChI=1S/C19H29N5OS/c20-11-16-13-24(22-21-16)12-15-6-8-23(9-7-15)14-17-4-5-19(26-17)18-3-1-2-10-25-18/h4-5,13,15,18H,1-3,6-12,14,20H2 |
| InChIKey | AEOPRKZXOIGBHO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |