C17H23N3O3 — CID 45228021
N-(1-cycloheptyl-5-oxopyrrolidin-3-yl)-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 45228021) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(1-cycloheptyl-5-oxopyrrolidin-3-yl)-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-(1-cycloheptyl-5-oxopyrrolidin-3-yl)-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 45228021 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(1-cycloheptyl-5-oxopyrrolidin-3-yl)-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | O=C(NC1CC(=O)N(C2CCCCCC2)C1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C17H23N3O3/c21-16-11-14(12-20(16)15-5-3-1-2-4-6-15)18-17(22)13-7-9-19(23)10-8-13/h7-10,14-15H,1-6,11-12H2,(H,18,22) |
| InChIKey | ABDJPRDUKZJXRX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|