About (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone
(5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 45228137) has the molecular formula C19H25N5O2
and a molecular weight of 355.44 g/mol. Its IUPAC name is (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone |
| PubChem CID | 45228137 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | CCc1ocnc1C(=O)N1CCC(C2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C19H25N5O2/c1-2-16-17(22-13-26-16)18(25)24-11-6-15(12-24)14-4-9-23(10-5-14)19-20-7-3-8-21-19/h3,7-8,13-15H,2,4-6,9-12H2,1H3 |
| InChIKey | SNMQWABJEHVCAG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone?
The IUPAC name of (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone (CID 45228137) is (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone?
The canonical SMILES for (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone is CCc1ocnc1C(=O)N1CCC(C2CCN(c3ncccn3)CC2)C1.
What is the InChIKey of (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone?
The InChIKey is SNMQWABJEHVCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O2/c1-2-16-17(22-13-26-16)18(25)24-11-6-15(12-24)14-4-9-23(10-5-14)19-20-7-3-8-21-19/h3,7-8,13-15H,2,4-6,9-12H2,1H3.
What are the key properties of (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone?
(5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone has a molecular weight of 355.44 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,3-oxazol-4-yl)-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 45228137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).