C22H20FN3S — CID 45228441
5-[[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 45228441) has the molecular formula C22H20FN3S and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-[[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 45228441 |
| Molecular Formula | C22H20FN3S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[[1-(2-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CN2CCc3c([nH]c4ccccc34)C2c2ccccc2F)s1 |
| InChI | InChI=1S/C22H20FN3S/c1-14-24-12-15(27-14)13-26-11-10-17-16-6-3-5-9-20(16)25-21(17)22(26)18-7-2-4-8-19(18)23/h2-9,12,22,25H,10-11,13H2,1H3 |
| InChIKey | PZDJEEXLVFQWDA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|