About 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide
4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 4522863) has the molecular formula C9H7N5O3
and a molecular weight of 233.19 g/mol. Its IUPAC name is 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide |
| PubChem CID | 4522863 |
| Molecular Formula | C9H7N5O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7N5O3/c15-8(12-9-10-5-11-13-9)6-1-3-7(4-2-6)14(16)17/h1-5H,(H2,10,11,12,13,15) |
| InChIKey | ZGALGAJAQYISLR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide?
The IUPAC name of 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide (CID 4522863) is 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide.
What is the SMILES notation for 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide?
The canonical SMILES for 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide is O=C(Nc1ncn[nH]1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide?
The InChIKey is ZGALGAJAQYISLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5O3/c15-8(12-9-10-5-11-13-9)6-1-3-7(4-2-6)14(16)17/h1-5H,(H2,10,11,12,13,15).
What are the key properties of 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide?
4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide has a molecular weight of 233.19 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-(1H-1,2,4-triazol-5-yl)benzamide is sourced from PubChem (CID 4522863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).