C28H14O5 — CID 4522874
2-(9,10-dioxoanthracen-2-yl)oxyanthracene-9,10-dione (PubChem CID 4522874) has the molecular formula C28H14O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-(9,10-dioxoanthracen-2-yl)oxyanthracene-9,10-dione.
| Compound Name | 2-(9,10-dioxoanthracen-2-yl)oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 4522874 |
| Molecular Formula | C28H14O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-(9,10-dioxoanthracen-2-yl)oxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(Oc3ccc4c(c3)C(=O)c3ccccc3C4=O)ccc21 |
| InChI | InChI=1S/C28H14O5/c29-25-17-5-1-3-7-19(17)27(31)23-13-15(9-11-21(23)25)33-16-10-12-22-24(14-16)28(32)20-8-4-2-6-18(20)26(22)30/h1-14H |
| InChIKey | NNAJBFBCXBFPTD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|