C19H28N4O2S — CID 45228967
5-[[3-(3,4-dimethoxyanilino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 45228967) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-[[3-(3,4-dimethoxyanilino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[3-(3,4-dimethoxyanilino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 45228967 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-[[3-(3,4-dimethoxyanilino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(NC2CCCN(Cc3cnc(N(C)C)s3)C2)cc1OC |
| InChI | InChI=1S/C19H28N4O2S/c1-22(2)19-20-11-16(26-19)13-23-9-5-6-15(12-23)21-14-7-8-17(24-3)18(10-14)25-4/h7-8,10-11,15,21H,5-6,9,12-13H2,1-4H3 |
| InChIKey | UELSTDUSEUNGLW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|