C19H25N5O4 — CID 45229255
5-[5-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-3-yl]-6-methyl-N-propan-2-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide (PubChem CID 45229255) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[5-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-3-yl]-6-methyl-N-propan-2-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide.
| Compound Name | 5-[5-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-3-yl]-6-methyl-N-propan-2-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 45229255 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-[5-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-3-yl]-6-methyl-N-propan-2-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide |
| SMILES | Cc1ncc2c(c1-c1noc(C3COCCO3)n1)CCN(C(=O)NC(C)C)C2 |
| InChI | InChI=1S/C19H25N5O4/c1-11(2)21-19(25)24-5-4-14-13(9-24)8-20-12(3)16(14)17-22-18(28-23-17)15-10-26-6-7-27-15/h8,11,15H,4-7,9-10H2,1-3H3,(H,21,25) |
| InChIKey | VSEZXZJGYRTSLS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |