C15H25N3O3S — CID 45229526
N,2-dimethyl-N-[[2-methylsulfonyl-3-(oxolan-2-ylmethyl)imidazol-4-yl]methyl]prop-2-en-1-amine (PubChem CID 45229526) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N,2-dimethyl-N-[[2-methylsulfonyl-3-(oxolan-2-ylmethyl)imidazol-4-yl]methyl]prop-2-en-1-amine.
| Compound Name | N,2-dimethyl-N-[[2-methylsulfonyl-3-(oxolan-2-ylmethyl)imidazol-4-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 45229526 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N,2-dimethyl-N-[[2-methylsulfonyl-3-(oxolan-2-ylmethyl)imidazol-4-yl]methyl]prop-2-en-1-amine |
| SMILES | C=C(C)CN(C)Cc1cnc(S(C)(=O)=O)n1CC1CCCO1 |
| InChI | InChI=1S/C15H25N3O3S/c1-12(2)9-17(3)10-13-8-16-15(22(4,19)20)18(13)11-14-6-5-7-21-14/h8,14H,1,5-7,9-11H2,2-4H3 |
| InChIKey | ORPUXECXZKBXED-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|