About 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide
3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 45229854) has the molecular formula C20H19N5O2
and a molecular weight of 361.41 g/mol. Its IUPAC name is 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| PubChem CID | 45229854 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1cnn(-c2ccccc2)n1)C1CC(Cc2ccccc2)=NO1 |
| InChI | InChI=1S/C20H19N5O2/c26-20(19-12-16(24-27-19)11-15-7-3-1-4-8-15)21-13-17-14-22-25(23-17)18-9-5-2-6-10-18/h1-10,14,19H,11-13H2,(H,21,26) |
| InChIKey | XHKJALSKKMKGAJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (CID 45229854) is 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide is O=C(NCc1cnn(-c2ccccc2)n1)C1CC(Cc2ccccc2)=NO1.
What is the InChIKey of 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide?
The InChIKey is XHKJALSKKMKGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O2/c26-20(19-12-16(24-27-19)11-15-7-3-1-4-8-15)21-13-17-14-22-25(23-17)18-9-5-2-6-10-18/h1-10,14,19H,11-13H2,(H,21,26).
What are the key properties of 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide?
3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide has a molecular weight of 361.41 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N-[(2-phenyltriazol-4-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 45229854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).