C21H17ClN2O2S — CID 45230024
(E)-N-[(7-chloro-5-thiophen-3-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 45230024) has the molecular formula C21H17ClN2O2S and a molecular weight of 396.90 g/mol. Its IUPAC name is (E)-N-[(7-chloro-5-thiophen-3-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(7-chloro-5-thiophen-3-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 45230024 |
| Molecular Formula | C21H17ClN2O2S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (E)-N-[(7-chloro-5-thiophen-3-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCC1Cc2cc(-c3ccsc3)cc(Cl)c2O1 |
| InChI | InChI=1S/C21H17ClN2O2S/c22-19-10-16(15-5-7-27-13-15)8-17-9-18(26-21(17)19)12-24-20(25)4-3-14-2-1-6-23-11-14/h1-8,10-11,13,18H,9,12H2,(H,24,25)/b4-3+ |
| InChIKey | CQSSUQLPIOZWKL-ONEGZZNKSA-N |
| XLogP | 4.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|