About [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone
[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone (PubChem CID 45231273) has the molecular formula C19H25F2NO2
and a molecular weight of 337.41 g/mol. Its IUPAC name is [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone.
Molecular Properties
| Compound Name | [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone |
| PubChem CID | 45231273 |
| Molecular Formula | C19H25F2NO2 |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCCC(CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H25F2NO2/c20-17-6-5-14(12-18(17)21)3-4-15-2-1-9-22(13-15)19(23)16-7-10-24-11-8-16/h5-6,12,15-16H,1-4,7-11,13H2 |
| InChIKey | ZFILOXDDCWTFTA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone?
The IUPAC name of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone (CID 45231273) is [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone.
What is the SMILES notation for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone?
The canonical SMILES for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone is O=C(C1CCOCC1)N1CCCC(CCc2ccc(F)c(F)c2)C1.
What is the InChIKey of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone?
The InChIKey is ZFILOXDDCWTFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2NO2/c20-17-6-5-14(12-18(17)21)3-4-15-2-1-9-22(13-15)19(23)16-7-10-24-11-8-16/h5-6,12,15-16H,1-4,7-11,13H2.
What are the key properties of [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone?
[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone has a molecular weight of 337.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]-(oxan-4-yl)methanone is sourced from PubChem (CID 45231273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).