C18H26N4O3 — CID 45232321
methyl 4-oxo-4-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]butanoate (PubChem CID 45232321) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl 4-oxo-4-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]butanoate.
| Compound Name | methyl 4-oxo-4-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 45232321 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | methyl 4-oxo-4-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)CCC(=O)N1CCC(C2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-25-17(24)4-3-16(23)22-12-7-15(13-22)14-5-10-21(11-6-14)18-19-8-2-9-20-18/h2,8-9,14-15H,3-7,10-13H2,1H3 |
| InChIKey | YYMDEVUGBCTOAT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |