C24H33ClN4O — CID 45232442
2-chloro-N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]benzamide (PubChem CID 45232442) has the molecular formula C24H33ClN4O and a molecular weight of 429.01 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 45232442 |
| Molecular Formula | C24H33ClN4O |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-chloro-N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
| SMILES | CC(C)=CCCC(C)CN1CCC(n2nccc2NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H33ClN4O/c1-18(2)7-6-8-19(3)17-28-15-12-20(13-16-28)29-23(11-14-26-29)27-24(30)21-9-4-5-10-22(21)25/h4-5,7,9-11,14,19-20H,6,8,12-13,15-17H2,1-3H3,(H,27,30) |
| InChIKey | CVEJESBCASOLGW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|