C19H26N4O2S — CID 45233337
5-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 45233337) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 5-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 45233337 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 5-[[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ncc(CN2CCCC(Nc3ccc4c(c3)OCCO4)C2)s1 |
| InChI | InChI=1S/C19H26N4O2S/c1-22(2)19-20-11-16(26-19)13-23-7-3-4-15(12-23)21-14-5-6-17-18(10-14)25-9-8-24-17/h5-6,10-11,15,21H,3-4,7-9,12-13H2,1-2H3 |
| InChIKey | LGAKYYQQPDOXCQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|