C18H22F3N3O — CID 45234546
4-[(1-ethylpyrazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 45234546) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is 4-[(1-ethylpyrazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | 4-[(1-ethylpyrazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 45234546 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4-[(1-ethylpyrazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | CCn1cc(CN2CCOC(Cc3cccc(C(F)(F)F)c3)C2)cn1 |
| InChI | InChI=1S/C18H22F3N3O/c1-2-24-12-15(10-22-24)11-23-6-7-25-17(13-23)9-14-4-3-5-16(8-14)18(19,20)21/h3-5,8,10,12,17H,2,6-7,9,11,13H2,1H3 |
| InChIKey | XKCUIBTWHSGESA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |