C19H20FN3S — CID 45237286
3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(thiophen-2-ylmethyl)piperidine (PubChem CID 45237286) has the molecular formula C19H20FN3S and a molecular weight of 341.45 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(thiophen-2-ylmethyl)piperidine.
| Compound Name | 3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(thiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 45237286 |
| Molecular Formula | C19H20FN3S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]-1-(thiophen-2-ylmethyl)piperidine |
| SMILES | Fc1ccc(-c2cn[nH]c2C2CCCN(Cc3cccs3)C2)cc1 |
| InChI | InChI=1S/C19H20FN3S/c20-16-7-5-14(6-8-16)18-11-21-22-19(18)15-3-1-9-23(12-15)13-17-4-2-10-24-17/h2,4-8,10-11,15H,1,3,9,12-13H2,(H,21,22) |
| InChIKey | IBLUXRRYMPKSIU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |