About 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane
7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane (PubChem CID 45237461) has the molecular formula C18H32N4
and a molecular weight of 304.48 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane |
| PubChem CID | 45237461 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane |
| SMILES | Cn1cc(CN2CCC3(CCCN(CC(C)(C)C)C3)C2)cn1 |
| InChI | InChI=1S/C18H32N4/c1-17(2,3)13-22-8-5-6-18(15-22)7-9-21(14-18)12-16-10-19-20(4)11-16/h10-11H,5-9,12-15H2,1-4H3 |
| InChIKey | AAWMCDUOGYHGBU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane?
The IUPAC name of 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane (CID 45237461) is 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane is Cn1cc(CN2CCC3(CCCN(CC(C)(C)C)C3)C2)cn1.
What is the InChIKey of 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane?
The InChIKey is AAWMCDUOGYHGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4/c1-17(2,3)13-22-8-5-6-18(15-22)7-9-21(14-18)12-16-10-19-20(4)11-16/h10-11H,5-9,12-15H2,1-4H3.
What are the key properties of 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane?
7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane has a molecular weight of 304.48 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-dimethylpropyl)-2-[(1-methylpyrazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 45237461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).