C22H24N2O2 — CID 45237594
N-[[7-(5-methyl-2-pyridinyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 45237594) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[[7-(5-methyl-2-pyridinyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[[7-(5-methyl-2-pyridinyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 45237594 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[[7-(5-methyl-2-pyridinyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc(-c2cccc3c2OC(CNC(=O)C2CC=CCC2)C3)nc1 |
| InChI | InChI=1S/C22H24N2O2/c1-15-10-11-20(23-13-15)19-9-5-8-17-12-18(26-21(17)19)14-24-22(25)16-6-3-2-4-7-16/h2-3,5,8-11,13,16,18H,4,6-7,12,14H2,1H3,(H,24,25) |
| InChIKey | ZHAKVTRJLUBCES-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|