C18H25FN2O3 — CID 45237627
methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]-4-oxobutanoate (PubChem CID 45237627) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 45237627 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C)C1CCCN(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C18H25FN2O3/c1-20(17(22)9-10-18(23)24-2)15-7-5-11-21(13-15)12-14-6-3-4-8-16(14)19/h3-4,6,8,15H,5,7,9-13H2,1-2H3 |
| InChIKey | AAOWGEMMPYPNMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |