C21H30N2O3 — CID 45237888
3-(2-ethyl-5-oxopyrrolidin-2-yl)-N-[(4-phenyloxan-4-yl)methyl]propanamide (PubChem CID 45237888) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-(2-ethyl-5-oxopyrrolidin-2-yl)-N-[(4-phenyloxan-4-yl)methyl]propanamide.
| Compound Name | 3-(2-ethyl-5-oxopyrrolidin-2-yl)-N-[(4-phenyloxan-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 45237888 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-(2-ethyl-5-oxopyrrolidin-2-yl)-N-[(4-phenyloxan-4-yl)methyl]propanamide |
| SMILES | CCC1(CCC(=O)NCC2(c3ccccc3)CCOCC2)CCC(=O)N1 |
| InChI | InChI=1S/C21H30N2O3/c1-2-21(11-9-19(25)23-21)10-8-18(24)22-16-20(12-14-26-15-13-20)17-6-4-3-5-7-17/h3-7H,2,8-16H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | OHNXUMMXJLBSNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |