C35H30N2O4 — CID 4523906
N-(benzylideneamino)-3,4,5-tris(phenylmethoxy)benzamide (PubChem CID 4523906) has the molecular formula C35H30N2O4 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-(benzylideneamino)-3,4,5-tris(phenylmethoxy)benzamide.
| Compound Name | N-(benzylideneamino)-3,4,5-tris(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 4523906 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | N-(benzylideneamino)-3,4,5-tris(phenylmethoxy)benzamide |
| SMILES | O=C(NN=Cc1ccccc1)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C35H30N2O4/c38-35(37-36-23-27-13-5-1-6-14-27)31-21-32(39-24-28-15-7-2-8-16-28)34(41-26-30-19-11-4-12-20-30)33(22-31)40-25-29-17-9-3-10-18-29/h1-23H,24-26H2,(H,37,38) |
| InChIKey | VTGRCDPJIRJVRH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|